C14H21ClN2O4 — CID 88938441
4,5-bis(2-methoxyethoxy)-2-(methylamino)benzenecarboximidoyl chloride (PubChem CID 88938441) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 4,5-bis(2-methoxyethoxy)-2-(methylamino)benzenecarboximidoyl chloride.
| Compound Name | 4,5-bis(2-methoxyethoxy)-2-(methylamino)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 88938441 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4,5-bis(2-methoxyethoxy)-2-(methylamino)benzenecarboximidoyl chloride |
| SMILES | [H]/N=C(\Cl)c1cc(OCCOC)c(OCCOC)cc1NC |
| InChI | InChI=1S/C14H21ClN2O4/c1-17-11-9-13(21-7-5-19-3)12(20-6-4-18-2)8-10(11)14(15)16/h8-9,16-17H,4-7H2,1-3H3/b16-14- |
| InChIKey | BHCVJXRKKXIOJH-PEZBUJJGSA-N |
| XLogP | 2.34 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|