C16H24N2O6S — CID 169356168
ethyl 2-(carbamothioylamino)-4,5-bis(2-methoxyethoxy)benzoate (PubChem CID 169356168) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is ethyl 2-(carbamothioylamino)-4,5-bis(2-methoxyethoxy)benzoate.
| Compound Name | ethyl 2-(carbamothioylamino)-4,5-bis(2-methoxyethoxy)benzoate |
|---|---|
| PubChem CID | 169356168 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | ethyl 2-(carbamothioylamino)-4,5-bis(2-methoxyethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1NC(N)=S |
| InChI | InChI=1S/C16H24N2O6S/c1-4-22-15(19)11-9-13(23-7-5-20-2)14(24-8-6-21-3)10-12(11)18-16(17)25/h9-10H,4-8H2,1-3H3,(H3,17,18,25) |
| InChIKey | QECGXXKKVTUCPA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|