C20H30O10 — CID 101102266
diethyl 2,5-bis[2-(2-hydroxyethoxy)ethoxy]benzene-1,4-dicarboxylate (PubChem CID 101102266) has the molecular formula C20H30O10 and a molecular weight of 430.45 g/mol. Its IUPAC name is diethyl 2,5-bis[2-(2-hydroxyethoxy)ethoxy]benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[2-(2-hydroxyethoxy)ethoxy]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101102266 |
| Molecular Formula | C20H30O10 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | diethyl 2,5-bis[2-(2-hydroxyethoxy)ethoxy]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCCOCCO)c(C(=O)OCC)cc1OCCOCCO |
| InChI | InChI=1S/C20H30O10/c1-3-27-19(23)15-13-18(30-12-10-26-8-6-22)16(20(24)28-4-2)14-17(15)29-11-9-25-7-5-21/h13-14,21-22H,3-12H2,1-2H3 |
| InChIKey | SEJKXMFNBHFUPY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|