C27H36O7 — CID 134215432
diethyl 2-(8-hydroxyoctoxy)-5-phenylmethoxybenzene-1,4-dicarboxylate (PubChem CID 134215432) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is diethyl 2-(8-hydroxyoctoxy)-5-phenylmethoxybenzene-1,4-dicarboxylate.
| Compound Name | diethyl 2-(8-hydroxyoctoxy)-5-phenylmethoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134215432 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | diethyl 2-(8-hydroxyoctoxy)-5-phenylmethoxybenzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c(C(=O)OCC)cc1OCCCCCCCCO |
| InChI | InChI=1S/C27H36O7/c1-3-31-26(29)22-19-25(34-20-21-14-10-9-11-15-21)23(27(30)32-4-2)18-24(22)33-17-13-8-6-5-7-12-16-28/h9-11,14-15,18-19,28H,3-8,12-13,16-17,20H2,1-2H3 |
| InChIKey | RMTPBCXPADVEEE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|