C60H54O10 — CID 10396060
ethyl 2-[6-ethoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate (PubChem CID 10396060) has the molecular formula C60H54O10 and a molecular weight of 935.08 g/mol. Its IUPAC name is ethyl 2-[6-ethoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate.
| Compound Name | ethyl 2-[6-ethoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 10396060 |
| Molecular Formula | C60H54O10 |
| Molecular Weight | 935.08 g/mol |
| Exact Mass | 934.37 |
| IUPAC Name | ethyl 2-[6-ethoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1-c1c(C(=O)OCC)cc(OCc2ccccc2)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C60H54O10/c1-3-63-59(61)49-35-51(65-37-43-23-11-5-12-24-43)55(67-39-45-27-15-7-16-28-45)57(69-41-47-31-19-9-20-32-47)53(49)54-50(60(62)64-4-2)36-52(66-38-44-25-13-6-14-26-44)56(68-40-46-29-17-8-18-30-46)58(54)70-42-48-33-21-10-22-34-48/h5-36H,3-4,37-42H2,1-2H3 |
| InChIKey | XSJRLHZLEFNPLR-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.08 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |