C17H18O6S — CID 54676787
diethyl 3-hydroxy-4-phenylmethoxythiophene-2,5-dicarboxylate (PubChem CID 54676787) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is diethyl 3-hydroxy-4-phenylmethoxythiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3-hydroxy-4-phenylmethoxythiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 54676787 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | diethyl 3-hydroxy-4-phenylmethoxythiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc(C(=O)OCC)c(OCc2ccccc2)c1O |
| InChI | InChI=1S/C17H18O6S/c1-3-21-16(19)14-12(18)13(15(24-14)17(20)22-4-2)23-10-11-8-6-5-7-9-11/h5-9,18H,3-4,10H2,1-2H3 |
| InChIKey | DWIJFOKYEKQYAI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|