C46H70O12S2Si2 — CID 132548972
diethyl 3-[[3-[[2,5-bis(ethoxycarbonyl)-4-tri(propan-2-yl)silyloxythiophen-3-yl]oxymethyl]phenyl]methoxy]-4-tri(propan-2-yl)silyloxythiophene-2,5-dicarboxylate (PubChem CID 132548972) has the molecular formula C46H70O12S2Si2 and a molecular weight of 935.36 g/mol. Its IUPAC name is diethyl 3-[[3-[[2,5-bis(ethoxycarbonyl)-4-tri(propan-2-yl)silyloxythiophen-3-yl]oxymethyl]phenyl]methoxy]-4-tri(propan-2-yl)silyloxythiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3-[[3-[[2,5-bis(ethoxycarbonyl)-4-tri(propan-2-yl)silyloxythiophen-3-yl]oxymethyl]phenyl]methoxy]-4-tri(propan-2-yl)silyloxythiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 132548972 |
| Molecular Formula | C46H70O12S2Si2 |
| Molecular Weight | 935.36 g/mol |
| Exact Mass | 934.38 |
| IUPAC Name | diethyl 3-[[3-[[2,5-bis(ethoxycarbonyl)-4-tri(propan-2-yl)silyloxythiophen-3-yl]oxymethyl]phenyl]methoxy]-4-tri(propan-2-yl)silyloxythiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc(C(=O)OCC)c(O[Si](C(C)C)(C(C)C)C(C)C)c1OCc1cccc(COc2c(C(=O)OCC)sc(C(=O)OCC)c2O[Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C46H70O12S2Si2/c1-17-51-43(47)39-35(37(41(59-39)45(49)53-19-3)57-61(27(5)6,28(7)8)29(9)10)55-25-33-22-21-23-34(24-33)26-56-36-38(58-62(30(11)12,31(13)14)32(15)16)42(46(50)54-20-4)60-40(36)44(48)52-18-2/h21-24,27-32H,17-20,25-26H2,1-16H3 |
| InChIKey | POUBTNOJEMJWRO-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.36 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|