C22H18Cl2O4S — CID 102198331
3,4-bis[(3-methylphenyl)methoxy]thiophene-2,5-dicarbonyl chloride (PubChem CID 102198331) has the molecular formula C22H18Cl2O4S and a molecular weight of 449.36 g/mol. Its IUPAC name is 3,4-bis[(3-methylphenyl)methoxy]thiophene-2,5-dicarbonyl chloride.
| Compound Name | 3,4-bis[(3-methylphenyl)methoxy]thiophene-2,5-dicarbonyl chloride |
|---|---|
| PubChem CID | 102198331 |
| Molecular Formula | C22H18Cl2O4S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 3,4-bis[(3-methylphenyl)methoxy]thiophene-2,5-dicarbonyl chloride |
| SMILES | Cc1cccc(COc2c(C(=O)Cl)sc(C(=O)Cl)c2OCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C22H18Cl2O4S/c1-13-5-3-7-15(9-13)11-27-17-18(20(22(24)26)29-19(17)21(23)25)28-12-16-8-4-6-14(2)10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | KFOUDXLRBHNKCH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|