C17H16Br2O3 — CID 10113366
3-[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]propanoic acid (PubChem CID 10113366) has the molecular formula C17H16Br2O3 and a molecular weight of 428.12 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10113366 |
| Molecular Formula | C17H16Br2O3 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | 3-[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc(COc2c(Br)cc(CCC(=O)O)cc2Br)c1 |
| InChI | InChI=1S/C17H16Br2O3/c1-11-3-2-4-13(7-11)10-22-17-14(18)8-12(9-15(17)19)5-6-16(20)21/h2-4,7-9H,5-6,10H2,1H3,(H,20,21) |
| InChIKey | OSDJZABHEFWQAU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |