C20H19Br2NO4 — CID 69014678
3-[3,5-dibromo-4-[[3-[[(E)-but-2-enoyl]amino]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 69014678) has the molecular formula C20H19Br2NO4 and a molecular weight of 497.18 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-[[3-[[(E)-but-2-enoyl]amino]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dibromo-4-[[3-[[(E)-but-2-enoyl]amino]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69014678 |
| Molecular Formula | C20H19Br2NO4 |
| Molecular Weight | 497.18 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | 3-[3,5-dibromo-4-[[3-[[(E)-but-2-enoyl]amino]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | C/C=C/C(=O)Nc1cccc(COc2c(Br)cc(CCC(=O)O)cc2Br)c1 |
| InChI | InChI=1S/C20H19Br2NO4/c1-2-4-18(24)23-15-6-3-5-14(9-15)12-27-20-16(21)10-13(11-17(20)22)7-8-19(25)26/h2-6,9-11H,7-8,12H2,1H3,(H,23,24)(H,25,26)/b4-2+ |
| InChIKey | ZCCFZCMIZBYIEM-DUXPYHPUSA-N |
| XLogP | 5.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.18 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|