C16H15Br2NO3 — CID 69246244
2-[3,5-dibromo-4-[[3-(methylamino)phenyl]methoxy]phenyl]acetic acid (PubChem CID 69246244) has the molecular formula C16H15Br2NO3 and a molecular weight of 429.11 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[[3-(methylamino)phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibromo-4-[[3-(methylamino)phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 69246244 |
| Molecular Formula | C16H15Br2NO3 |
| Molecular Weight | 429.11 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 2-[3,5-dibromo-4-[[3-(methylamino)phenyl]methoxy]phenyl]acetic acid |
| SMILES | CNc1cccc(COc2c(Br)cc(CC(=O)O)cc2Br)c1 |
| InChI | InChI=1S/C16H15Br2NO3/c1-19-12-4-2-3-10(5-12)9-22-16-13(17)6-11(7-14(16)18)8-15(20)21/h2-7,19H,8-9H2,1H3,(H,20,21) |
| InChIKey | XCLMPTIRXZXRHC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.11 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |