C27H37NO3Si — CID 10049503
ethyl 1-benzyl-2-tri(propan-2-yl)silyloxyindole-3-carboxylate (PubChem CID 10049503) has the molecular formula C27H37NO3Si and a molecular weight of 451.68 g/mol. Its IUPAC name is ethyl 1-benzyl-2-tri(propan-2-yl)silyloxyindole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-2-tri(propan-2-yl)silyloxyindole-3-carboxylate |
|---|---|
| PubChem CID | 10049503 |
| Molecular Formula | C27H37NO3Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | ethyl 1-benzyl-2-tri(propan-2-yl)silyloxyindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(O[Si](C(C)C)(C(C)C)C(C)C)n(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H37NO3Si/c1-8-30-27(29)25-23-16-12-13-17-24(23)28(18-22-14-10-9-11-15-22)26(25)31-32(19(2)3,20(4)5)21(6)7/h9-17,19-21H,8,18H2,1-7H3 |
| InChIKey | VPALSLLSAIWGRZ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|