C21H19N3O3 — CID 134840109
ethyl 5-benzyl-4-(hydroxymethyl)pyrimido[5,4-b]indole-2-carboxylate (PubChem CID 134840109) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is ethyl 5-benzyl-4-(hydroxymethyl)pyrimido[5,4-b]indole-2-carboxylate.
| Compound Name | ethyl 5-benzyl-4-(hydroxymethyl)pyrimido[5,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 134840109 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | ethyl 5-benzyl-4-(hydroxymethyl)pyrimido[5,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(CO)c2c(n1)c1ccccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C21H19N3O3/c1-2-27-21(26)20-22-16(13-25)19-18(23-20)15-10-6-7-11-17(15)24(19)12-14-8-4-3-5-9-14/h3-11,25H,2,12-13H2,1H3 |
| InChIKey | QWIAHFSBJZETDY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |