C12H12ClN3O2 — CID 155357284
ethyl 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylate (PubChem CID 155357284) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is ethyl 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 155357284 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | ethyl 1-benzyl-5-chloro-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1nc(Cl)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-2-18-11(17)10-14-12(13)16(15-10)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | GCWHEIAWGOXSEW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |