C17H19NO6 — CID 54682554
diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate (PubChem CID 54682554) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate.
| Compound Name | diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 54682554 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(O)c(O)c(C(=O)OCC)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-3-23-16(21)12-14(19)15(20)13(17(22)24-4-2)18(12)10-11-8-6-5-7-9-11/h5-9,19-20H,3-4,10H2,1-2H3 |
| InChIKey | AXYCCUUFBQELMR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |