C16H17NO6 — CID 2801528
diethyl 3,4-dihydroxy-1-phenylpyrrole-2,5-dicarboxylate (PubChem CID 2801528) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is diethyl 3,4-dihydroxy-1-phenylpyrrole-2,5-dicarboxylate.
| Compound Name | diethyl 3,4-dihydroxy-1-phenylpyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 2801528 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | diethyl 3,4-dihydroxy-1-phenylpyrrole-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(O)c(O)c(C(=O)OCC)n1-c1ccccc1 |
| InChI | InChI=1S/C16H17NO6/c1-3-22-15(20)11-13(18)14(19)12(16(21)23-4-2)17(11)10-8-6-5-7-9-10/h5-9,18-19H,3-4H2,1-2H3 |
| InChIKey | QTDVZSVRYIDDQL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |