About ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate
ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate (PubChem CID 71599633) has the molecular formula C16H17IN2O5
and a molecular weight of 444.23 g/mol. Its IUPAC name is ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate |
| PubChem CID | 71599633 |
| Molecular Formula | C16H17IN2O5 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(O)c(O)c(C(=O)N(C)C)n1-c1ccc(I)cc1 |
| InChI | InChI=1S/C16H17IN2O5/c1-4-24-16(23)12-14(21)13(20)11(15(22)18(2)3)19(12)10-7-5-9(17)6-8-10/h5-8,20-21H,4H2,1-3H3 |
| InChIKey | VVTRQWNRKFXCCB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate?
The IUPAC name of ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate (CID 71599633) is ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate?
The canonical SMILES for ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate is CCOC(=O)c1c(O)c(O)c(C(=O)N(C)C)n1-c1ccc(I)cc1.
What is the InChIKey of ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate?
The InChIKey is VVTRQWNRKFXCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17IN2O5/c1-4-24-16(23)12-14(21)13(20)11(15(22)18(2)3)19(12)10-7-5-9(17)6-8-10/h5-8,20-21H,4H2,1-3H3.
What are the key properties of ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate?
ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate has a molecular weight of 444.23 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(dimethylcarbamoyl)-3,4-dihydroxy-1-(4-iodophenyl)pyrrole-2-carboxylate is sourced from PubChem (CID 71599633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).