C37H42N2O16P2 — CID 121326922
ethyl 3,4-bis[[4-(dimethoxyphosphoryloxymethyl)benzoyl]oxy]-5-(dimethylcarbamoyl)-1-(4-methoxyphenyl)pyrrole-2-carboxylate (PubChem CID 121326922) has the molecular formula C37H42N2O16P2 and a molecular weight of 832.69 g/mol. Its IUPAC name is ethyl 3,4-bis[[4-(dimethoxyphosphoryloxymethyl)benzoyl]oxy]-5-(dimethylcarbamoyl)-1-(4-methoxyphenyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 3,4-bis[[4-(dimethoxyphosphoryloxymethyl)benzoyl]oxy]-5-(dimethylcarbamoyl)-1-(4-methoxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 121326922 |
| Molecular Formula | C37H42N2O16P2 |
| Molecular Weight | 832.69 g/mol |
| Exact Mass | 832.20 |
| IUPAC Name | ethyl 3,4-bis[[4-(dimethoxyphosphoryloxymethyl)benzoyl]oxy]-5-(dimethylcarbamoyl)-1-(4-methoxyphenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(OC(=O)c2ccc(COP(=O)(OC)OC)cc2)c(OC(=O)c2ccc(COP(=O)(OC)OC)cc2)c(C(=O)N(C)C)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C37H42N2O16P2/c1-9-51-37(43)31-33(55-36(42)27-16-12-25(13-17-27)23-53-57(45,49-7)50-8)32(30(34(40)38(2)3)39(31)28-18-20-29(46-4)21-19-28)54-35(41)26-14-10-24(11-15-26)22-52-56(44,47-5)48-6/h10-21H,9,22-23H2,1-8H3 |
| InChIKey | SYIYCTOWABNJHB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 202.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|