C16H17NO5 — CID 71370863
diethyl 3-hydroxy-1-phenylpyrrole-2,4-dicarboxylate (PubChem CID 71370863) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is diethyl 3-hydroxy-1-phenylpyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 3-hydroxy-1-phenylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 71370863 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | diethyl 3-hydroxy-1-phenylpyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2)c(C(=O)OCC)c1O |
| InChI | InChI=1S/C16H17NO5/c1-3-21-15(19)12-10-17(11-8-6-5-7-9-11)13(14(12)18)16(20)22-4-2/h5-10,18H,3-4H2,1-2H3 |
| InChIKey | WOTPRAGEWZGFGF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |