C21H23NO7 — CID 162715184
triethyl 1-(2-methylphenyl)-4-oxopyridine-2,3,5-tricarboxylate (PubChem CID 162715184) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is triethyl 1-(2-methylphenyl)-4-oxopyridine-2,3,5-tricarboxylate.
| Compound Name | triethyl 1-(2-methylphenyl)-4-oxopyridine-2,3,5-tricarboxylate |
|---|---|
| PubChem CID | 162715184 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | triethyl 1-(2-methylphenyl)-4-oxopyridine-2,3,5-tricarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2C)c(C(=O)OCC)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C21H23NO7/c1-5-27-19(24)14-12-22(15-11-9-8-10-13(15)4)17(21(26)29-7-3)16(18(14)23)20(25)28-6-2/h8-12H,5-7H2,1-4H3 |
| InChIKey | FFWHRXZMEKWAJL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|