C24H24N2O6 — CID 135034315
2-O-ethyl 3-O,4-O-dimethyl 1-[2-(benzylamino)phenyl]pyrrole-2,3,4-tricarboxylate (PubChem CID 135034315) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl 1-[2-(benzylamino)phenyl]pyrrole-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl 1-[2-(benzylamino)phenyl]pyrrole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135034315 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl 1-[2-(benzylamino)phenyl]pyrrole-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OC)c(C(=O)OC)cn1-c1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C24H24N2O6/c1-4-32-24(29)21-20(23(28)31-3)17(22(27)30-2)15-26(21)19-13-9-8-12-18(19)25-14-16-10-6-5-7-11-16/h5-13,15,25H,4,14H2,1-3H3 |
| InChIKey | UKSJJAUGISGKLF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|