C21H20F3NO7 — CID 175190937
triethyl 4-oxo-1-[2-(trifluoromethyl)phenyl]pyridine-2,3,5-tricarboxylate (PubChem CID 175190937) has the molecular formula C21H20F3NO7 and a molecular weight of 455.39 g/mol. Its IUPAC name is triethyl 4-oxo-1-[2-(trifluoromethyl)phenyl]pyridine-2,3,5-tricarboxylate.
| Compound Name | triethyl 4-oxo-1-[2-(trifluoromethyl)phenyl]pyridine-2,3,5-tricarboxylate |
|---|---|
| PubChem CID | 175190937 |
| Molecular Formula | C21H20F3NO7 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | triethyl 4-oxo-1-[2-(trifluoromethyl)phenyl]pyridine-2,3,5-tricarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccccc2C(F)(F)F)c(C(=O)OCC)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C21H20F3NO7/c1-4-30-18(27)12-11-25(14-10-8-7-9-13(14)21(22,23)24)16(20(29)32-6-3)15(17(12)26)19(28)31-5-2/h7-11H,4-6H2,1-3H3 |
| InChIKey | NYQWLHGRMDAMAV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|