C20H19F2NO7 — CID 175188234
triethyl 1-(3,4-difluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate (PubChem CID 175188234) has the molecular formula C20H19F2NO7 and a molecular weight of 423.37 g/mol. Its IUPAC name is triethyl 1-(3,4-difluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate.
| Compound Name | triethyl 1-(3,4-difluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate |
|---|---|
| PubChem CID | 175188234 |
| Molecular Formula | C20H19F2NO7 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | triethyl 1-(3,4-difluorophenyl)-4-oxopyridine-2,3,5-tricarboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)c(F)c2)c(C(=O)OCC)c(C(=O)OCC)c1=O |
| InChI | InChI=1S/C20H19F2NO7/c1-4-28-18(25)12-10-23(11-7-8-13(21)14(22)9-11)16(20(27)30-6-3)15(17(12)24)19(26)29-5-2/h7-10H,4-6H2,1-3H3 |
| InChIKey | XGFSDUBFXAHMQZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|