C20H22FNO4P2 — CID 142119745
ethane;ethyl 7-fluoro-4-oxo-6-phosphanyl-1-(4-phosphanyloxyphenyl)quinoline-3-carboxylate (PubChem CID 142119745) has the molecular formula C20H22FNO4P2 and a molecular weight of 421.35 g/mol. Its IUPAC name is ethane;ethyl 7-fluoro-4-oxo-6-phosphanyl-1-(4-phosphanyloxyphenyl)quinoline-3-carboxylate.
| Compound Name | ethane;ethyl 7-fluoro-4-oxo-6-phosphanyl-1-(4-phosphanyloxyphenyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142119745 |
| Molecular Formula | C20H22FNO4P2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | ethane;ethyl 7-fluoro-4-oxo-6-phosphanyl-1-(4-phosphanyloxyphenyl)quinoline-3-carboxylate |
| SMILES | CC.CCOC(=O)c1cn(-c2ccc(OP)cc2)c2cc(F)c(P)cc2c1=O |
| InChI | InChI=1S/C18H16FNO4P2.C2H6/c1-2-23-18(22)13-9-20(10-3-5-11(24-26)6-4-10)15-8-14(19)16(25)7-12(15)17(13)21;1-2/h3-9H,2,25-26H2,1H3;1-2H3 |
| InChIKey | LNJBPVFYCSCMAV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|