C18H10F4N2O5 — CID 15860364
ethyl 1-(2,4-difluoro-5-nitrophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 15860364) has the molecular formula C18H10F4N2O5 and a molecular weight of 410.28 g/mol. Its IUPAC name is ethyl 1-(2,4-difluoro-5-nitrophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(2,4-difluoro-5-nitrophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15860364 |
| Molecular Formula | C18H10F4N2O5 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | ethyl 1-(2,4-difluoro-5-nitrophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc([N+](=O)[O-])c(F)cc2F)c2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C18H10F4N2O5/c1-2-29-18(26)9-7-23(14-5-11(20)10(19)3-8(14)17(9)25)15-6-16(24(27)28)13(22)4-12(15)21/h3-7H,2H2,1H3 |
| InChIKey | HQYFVESMFLMEMQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|