C18H11ClF3N3O4 — CID 54467666
ethyl 7-chloro-1-(2,4-difluoro-5-formamidophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 54467666) has the molecular formula C18H11ClF3N3O4 and a molecular weight of 425.75 g/mol. Its IUPAC name is ethyl 7-chloro-1-(2,4-difluoro-5-formamidophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-chloro-1-(2,4-difluoro-5-formamidophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 54467666 |
| Molecular Formula | C18H11ClF3N3O4 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | ethyl 7-chloro-1-(2,4-difluoro-5-formamidophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(NC=O)c(F)cc2F)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C18H11ClF3N3O4/c1-2-29-18(28)9-6-25(14-5-13(23-7-26)10(20)4-11(14)21)17-8(15(9)27)3-12(22)16(19)24-17/h3-7H,2H2,1H3,(H,23,26) |
| InChIKey | XGBWSGSFWFLFHD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|