C18H11ClFN3O3S — CID 10938318
ethyl 1-(1,3-benzothiazol-2-yl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 10938318) has the molecular formula C18H11ClFN3O3S and a molecular weight of 403.82 g/mol. Its IUPAC name is ethyl 1-(1,3-benzothiazol-2-yl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-(1,3-benzothiazol-2-yl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 10938318 |
| Molecular Formula | C18H11ClFN3O3S |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | ethyl 1-(1,3-benzothiazol-2-yl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2nc3ccccc3s2)c2nc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C18H11ClFN3O3S/c1-2-26-17(25)10-8-23(18-21-12-5-3-4-6-13(12)27-18)16-9(14(10)24)7-11(20)15(19)22-16/h3-8H,2H2,1H3 |
| InChIKey | DKRXDZKHRSOIIE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|