C12H6ClFN4O3S — CID 19939831
7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 19939831) has the molecular formula C12H6ClFN4O3S and a molecular weight of 340.72 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19939831 |
| Molecular Formula | C12H6ClFN4O3S |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 7-chloro-6-fluoro-1-(3-methyl-1,2,4-thiadiazol-5-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1nsc(-n2cc(C(=O)O)c(=O)c3cc(F)c(Cl)nc32)n1 |
| InChI | InChI=1S/C12H6ClFN4O3S/c1-4-15-12(22-17-4)18-3-6(11(20)21)8(19)5-2-7(14)9(13)16-10(5)18/h2-3H,1H3,(H,20,21) |
| InChIKey | FTSMSPJQIADRNG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|