C14H14ClFN2O5 — CID 139766013
7-chloro-6-fluoro-1-[2-(1-methoxyethoxy)ethyl]-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 139766013) has the molecular formula C14H14ClFN2O5 and a molecular weight of 344.73 g/mol. Its IUPAC name is 7-chloro-6-fluoro-1-[2-(1-methoxyethoxy)ethyl]-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-chloro-6-fluoro-1-[2-(1-methoxyethoxy)ethyl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 139766013 |
| Molecular Formula | C14H14ClFN2O5 |
| Molecular Weight | 344.73 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 7-chloro-6-fluoro-1-[2-(1-methoxyethoxy)ethyl]-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | COC(C)OCCn1cc(C(=O)O)c(=O)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C14H14ClFN2O5/c1-7(22-2)23-4-3-18-6-9(14(20)21)11(19)8-5-10(16)12(15)17-13(8)18/h5-7H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | GNAQUNHGODULON-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.73 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|