C13H9F3N2O5 — CID 21460303
1-(2-carbamoyloxyethyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 21460303) has the molecular formula C13H9F3N2O5 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(2-carbamoyloxyethyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2-carbamoyloxyethyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 21460303 |
| Molecular Formula | C13H9F3N2O5 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 1-(2-carbamoyloxyethyl)-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC(=O)OCCn1cc(C(=O)O)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C13H9F3N2O5/c14-7-3-5-10(9(16)8(7)15)18(1-2-23-13(17)22)4-6(11(5)19)12(20)21/h3-4H,1-2H2,(H2,17,22)(H,20,21) |
| InChIKey | AAHOKUHTMZUBCP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|