7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid

C14H13F2NO4 — CID 171060805

IUPAC7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid
SMILESCCOc1c(F)cc2c(=O)c(C(=O)O)cn(CC)c2c1F
InChIInChI=1S/C14H13F2NO4/c1-3-17-6-8(14(19)20)12(18)7-5-9(15)13(21-4-2)10(16)11(7)17/h5-6H,3-4H2,1-2H3,(H,19,20)
InChIKeyNKVSGQHTQMWQFL-UHFFFAOYSA-N
MW297.26 g/mol
LogP2.40
Rot. Bonds4

About 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid

7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 171060805) has the molecular formula C14H13F2NO4 and a molecular weight of 297.26 g/mol. Its IUPAC name is 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.

Molecular Properties

Compound Name7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid
PubChem CID171060805
Molecular FormulaC14H13F2NO4
Molecular Weight297.26 g/mol
Exact Mass297.08
IUPAC Name7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid
SMILESCCOc1c(F)cc2c(=O)c(C(=O)O)cn(CC)c2c1F
InChIInChI=1S/C14H13F2NO4/c1-3-17-6-8(14(19)20)12(18)7-5-9(15)13(21-4-2)10(16)11(7)17/h5-6H,3-4H2,1-2H3,(H,19,20)
InChIKeyNKVSGQHTQMWQFL-UHFFFAOYSA-N
XLogP2.40
TPSA68.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.26
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (CID 171060805) is 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid is CCOc1c(F)cc2c(=O)c(C(=O)O)cn(CC)c2c1F.
What is the InChIKey of 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid?
The InChIKey is NKVSGQHTQMWQFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO4/c1-3-17-6-8(14(19)20)12(18)7-5-9(15)13(21-4-2)10(16)11(7)17/h5-6H,3-4H2,1-2H3,(H,19,20).
What are the key properties of 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid?
7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid has a molecular weight of 297.26 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 171060805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).