C14H13F2NO4 — CID 171060805
7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 171060805) has the molecular formula C14H13F2NO4 and a molecular weight of 297.26 g/mol. Its IUPAC name is 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 171060805 |
| Molecular Formula | C14H13F2NO4 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 7-ethoxy-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCOc1c(F)cc2c(=O)c(C(=O)O)cn(CC)c2c1F |
| InChI | InChI=1S/C14H13F2NO4/c1-3-17-6-8(14(19)20)12(18)7-5-9(15)13(21-4-2)10(16)11(7)17/h5-6H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | NKVSGQHTQMWQFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |