C19H16F2N2O3 — CID 66650297
7-(benzylamino)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 66650297) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 7-(benzylamino)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(benzylamino)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 66650297 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 7-(benzylamino)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(NCc3ccccc3)c(F)c21 |
| InChI | InChI=1S/C19H16F2N2O3/c1-2-23-10-13(19(25)26)18(24)12-8-14(20)16(15(21)17(12)23)22-9-11-6-4-3-5-7-11/h3-8,10,22H,2,9H2,1H3,(H,25,26) |
| InChIKey | AVOAGNSVJLNPJS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |