C16H19F2N5O3 — CID 142634236
7-[(4-aminopiperazin-1-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 142634236) has the molecular formula C16H19F2N5O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 7-[(4-aminopiperazin-1-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4-aminopiperazin-1-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142634236 |
| Molecular Formula | C16H19F2N5O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 7-[(4-aminopiperazin-1-yl)amino]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(NN3CCN(N)CC3)c(F)c21 |
| InChI | InChI=1S/C16H19F2N5O3/c1-2-21-8-10(16(25)26)15(24)9-7-11(17)13(12(18)14(9)21)20-23-5-3-22(19)4-6-23/h7-8,20H,2-6,19H2,1H3,(H,25,26) |
| InChIKey | LERUMXOQOJUWFN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|