C21H22FN5O4 — CID 142634243
7-[(4-aminopiperazin-1-yl)amino]-6-fluoro-8-methoxy-4-oxo-1-phenylquinoline-3-carboxylic acid (PubChem CID 142634243) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is 7-[(4-aminopiperazin-1-yl)amino]-6-fluoro-8-methoxy-4-oxo-1-phenylquinoline-3-carboxylic acid.
| Compound Name | 7-[(4-aminopiperazin-1-yl)amino]-6-fluoro-8-methoxy-4-oxo-1-phenylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142634243 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 7-[(4-aminopiperazin-1-yl)amino]-6-fluoro-8-methoxy-4-oxo-1-phenylquinoline-3-carboxylic acid |
| SMILES | COc1c(NN2CCN(N)CC2)c(F)cc2c(=O)c(C(=O)O)cn(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H22FN5O4/c1-31-20-17(24-26-9-7-25(23)8-10-26)16(22)11-14-18(20)27(13-5-3-2-4-6-13)12-15(19(14)28)21(29)30/h2-6,11-12,24H,7-10,23H2,1H3,(H,29,30) |
| InChIKey | BEOYMSLZIVQUAV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|