C17H12ClF2N3O3 — CID 23284798
1-(5-amino-2-fluorophenyl)-8-chloro-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid (PubChem CID 23284798) has the molecular formula C17H12ClF2N3O3 and a molecular weight of 379.75 g/mol. Its IUPAC name is 1-(5-amino-2-fluorophenyl)-8-chloro-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(5-amino-2-fluorophenyl)-8-chloro-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23284798 |
| Molecular Formula | C17H12ClF2N3O3 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 1-(5-amino-2-fluorophenyl)-8-chloro-6-fluoro-7-(methylamino)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CNc1c(F)cc2c(=O)c(C(=O)O)cn(-c3cc(N)ccc3F)c2c1Cl |
| InChI | InChI=1S/C17H12ClF2N3O3/c1-22-14-11(20)5-8-15(13(14)18)23(6-9(16(8)24)17(25)26)12-4-7(21)2-3-10(12)19/h2-6,22H,21H2,1H3,(H,25,26) |
| InChIKey | TYTUSJLNQLWOCE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|