C15H8ClF2N3O3 — CID 10893526
1-(5-amino-2-fluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 10893526) has the molecular formula C15H8ClF2N3O3 and a molecular weight of 351.70 g/mol. Its IUPAC name is 1-(5-amino-2-fluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-(5-amino-2-fluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10893526 |
| Molecular Formula | C15H8ClF2N3O3 |
| Molecular Weight | 351.70 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1-(5-amino-2-fluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Nc1ccc(F)c(-n2cc(C(=O)O)c(=O)c3cc(F)c(Cl)nc32)c1 |
| InChI | InChI=1S/C15H8ClF2N3O3/c16-13-10(18)4-7-12(22)8(15(23)24)5-21(14(7)20-13)11-3-6(19)1-2-9(11)17/h1-5H,19H2,(H,23,24) |
| InChIKey | FUGJLUNNJZPMDJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|