C6H4ClFN2O2 — CID 165124028
2-amino-6-chloro-5-fluoropyridine-3-carboxylic acid (PubChem CID 165124028) has the molecular formula C6H4ClFN2O2 and a molecular weight of 190.56 g/mol. Its IUPAC name is 2-amino-6-chloro-5-fluoropyridine-3-carboxylic acid.
| Compound Name | 2-amino-6-chloro-5-fluoropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 165124028 |
| Molecular Formula | C6H4ClFN2O2 |
| Molecular Weight | 190.56 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | 2-amino-6-chloro-5-fluoropyridine-3-carboxylic acid |
| SMILES | Nc1nc(Cl)c(F)cc1C(=O)O |
| InChI | InChI=1S/C6H4ClFN2O2/c7-4-3(8)1-2(6(11)12)5(9)10-4/h1H,(H2,9,10)(H,11,12) |
| InChIKey | KVFFWMLUFMFDNY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|