C15H6ClF4N3O3 — CID 22441073
1-(3-amino-2,4,6-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 22441073) has the molecular formula C15H6ClF4N3O3 and a molecular weight of 387.68 g/mol. Its IUPAC name is 1-(3-amino-2,4,6-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-(3-amino-2,4,6-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22441073 |
| Molecular Formula | C15H6ClF4N3O3 |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 1-(3-amino-2,4,6-trifluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Nc1c(F)cc(F)c(-n2cc(C(=O)O)c(=O)c3cc(F)c(Cl)nc32)c1F |
| InChI | InChI=1S/C15H6ClF4N3O3/c16-13-8(19)1-4-12(24)5(15(25)26)3-23(14(4)22-13)11-7(18)2-6(17)10(21)9(11)20/h1-3H,21H2,(H,25,26) |
| InChIKey | MCUPPVPPCQVPBV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|