C19H15ClF3N5O3 — CID 57268969
(3-amino-3-methylazetidin-1-yl) 1-(5-amino-2,4-difluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 57268969) has the molecular formula C19H15ClF3N5O3 and a molecular weight of 453.81 g/mol. Its IUPAC name is (3-amino-3-methylazetidin-1-yl) 1-(5-amino-2,4-difluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | (3-amino-3-methylazetidin-1-yl) 1-(5-amino-2,4-difluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 57268969 |
| Molecular Formula | C19H15ClF3N5O3 |
| Molecular Weight | 453.81 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (3-amino-3-methylazetidin-1-yl) 1-(5-amino-2,4-difluorophenyl)-7-chloro-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CC1(N)CN(OC(=O)c2cn(-c3cc(N)c(F)cc3F)c3nc(Cl)c(F)cc3c2=O)C1 |
| InChI | InChI=1S/C19H15ClF3N5O3/c1-19(25)6-27(7-19)31-18(30)9-5-28(14-4-13(24)10(21)3-11(14)22)17-8(15(9)29)2-12(23)16(20)26-17/h2-5H,6-7,24-25H2,1H3 |
| InChIKey | KRHKJVQWGAEOJQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|