C21H17ClF4N4O3 — CID 57242814
[3-(aminomethyl)pyrrolidin-1-yl] 1-(5-amino-2,4-difluorophenyl)-8-chloro-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 57242814) has the molecular formula C21H17ClF4N4O3 and a molecular weight of 484.84 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl] 1-(5-amino-2,4-difluorophenyl)-8-chloro-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl] 1-(5-amino-2,4-difluorophenyl)-8-chloro-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 57242814 |
| Molecular Formula | C21H17ClF4N4O3 |
| Molecular Weight | 484.84 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl] 1-(5-amino-2,4-difluorophenyl)-8-chloro-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | NCC1CCN(OC(=O)c2cn(-c3cc(N)c(F)cc3F)c3c(Cl)c(F)c(F)cc3c2=O)C1 |
| InChI | InChI=1S/C21H17ClF4N4O3/c22-17-18(26)14(25)3-10-19(17)30(16-5-15(28)12(23)4-13(16)24)8-11(20(10)31)21(32)33-29-2-1-9(6-27)7-29/h3-5,8-9H,1-2,6-7,27-28H2 |
| InChIKey | QOUPNOJMUKOYCP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|