C19H11ClF4N2O4 — CID 54054955
ethyl 8-chloro-1-(2,4-difluoro-5-formamidophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate (PubChem CID 54054955) has the molecular formula C19H11ClF4N2O4 and a molecular weight of 442.75 g/mol. Its IUPAC name is ethyl 8-chloro-1-(2,4-difluoro-5-formamidophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-1-(2,4-difluoro-5-formamidophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 54054955 |
| Molecular Formula | C19H11ClF4N2O4 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | ethyl 8-chloro-1-(2,4-difluoro-5-formamidophenyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(NC=O)c(F)cc2F)c2c(Cl)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C19H11ClF4N2O4/c1-2-30-19(29)9-6-26(14-5-13(25-7-27)10(21)4-11(14)22)17-8(18(9)28)3-12(23)16(24)15(17)20/h3-7H,2H2,1H3,(H,25,27) |
| InChIKey | LVOVXJLGFJNIQN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|