C13H10ClFN2O4 — CID 3021289
ethyl 7-chloro-6-fluoro-1-formamido-4-oxoquinoline-3-carboxylate (PubChem CID 3021289) has the molecular formula C13H10ClFN2O4 and a molecular weight of 312.68 g/mol. Its IUPAC name is ethyl 7-chloro-6-fluoro-1-formamido-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 7-chloro-6-fluoro-1-formamido-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3021289 |
| Molecular Formula | C13H10ClFN2O4 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | ethyl 7-chloro-6-fluoro-1-formamido-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(NC=O)c2cc(Cl)c(F)cc2c1=O |
| InChI | InChI=1S/C13H10ClFN2O4/c1-2-21-13(20)8-5-17(16-6-18)11-4-9(14)10(15)3-7(11)12(8)19/h3-6H,2H2,1H3,(H,16,18) |
| InChIKey | JSRUDJNKLVNSGZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|