C15H11F3NNaO4 — CID 134869628
sodium (E)-2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)prop-1-en-1-olate (PubChem CID 134869628) has the molecular formula C15H11F3NNaO4 and a molecular weight of 349.24 g/mol. Its IUPAC name is sodium (E)-2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)prop-1-en-1-olate.
| Compound Name | sodium (E)-2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)prop-1-en-1-olate |
|---|---|
| PubChem CID | 134869628 |
| Molecular Formula | C15H11F3NNaO4 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | sodium (E)-2-(3-ethoxycarbonyl-6,7,8-trifluoro-4-oxoquinolin-1-yl)prop-1-en-1-olate |
| SMILES | CCOC(=O)c1cn(/C(C)=C/[O-])c2c(F)c(F)c(F)cc2c1=O.[Na+] |
| InChI | InChI=1S/C15H12F3NO4.Na/c1-3-23-15(22)9-5-19(7(2)6-20)13-8(14(9)21)4-10(16)11(17)12(13)18;/h4-6,20H,3H2,1-2H3;/q;+1/p-1/b7-6+; |
| InChIKey | KQSXAGDSMVLLQE-UHDJGPCESA-M |
| XLogP | -1.22 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|