C19H13ClF3NO3 — CID 10834539
ethyl 1-[(3-chlorophenyl)methyl]-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate (PubChem CID 10834539) has the molecular formula C19H13ClF3NO3 and a molecular weight of 395.76 g/mol. Its IUPAC name is ethyl 1-[(3-chlorophenyl)methyl]-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[(3-chlorophenyl)methyl]-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10834539 |
| Molecular Formula | C19H13ClF3NO3 |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | ethyl 1-[(3-chlorophenyl)methyl]-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2cccc(Cl)c2)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C19H13ClF3NO3/c1-2-27-19(26)13-9-24(8-10-4-3-5-11(20)6-10)17-12(18(13)25)7-14(21)15(22)16(17)23/h3-7,9H,2,8H2,1H3 |
| InChIKey | GHVLIOWTMIGVNY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|