C20H18F2N2O4 — CID 59002850
ethyl 5-amino-1-benzyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 59002850) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is ethyl 5-amino-1-benzyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 5-amino-1-benzyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 59002850 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 5-amino-1-benzyl-6,7-difluoro-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccccc2)c2c(OC)c(F)c(F)c(N)c2c1=O |
| InChI | InChI=1S/C20H18F2N2O4/c1-3-28-20(26)12-10-24(9-11-7-5-4-6-8-11)17-13(18(12)25)16(23)14(21)15(22)19(17)27-2/h4-8,10H,3,9,23H2,1-2H3 |
| InChIKey | HXBXRELRXURVRJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|