C20H16F3NO4 — CID 118585777
ethyl 4-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate (PubChem CID 118585777) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is ethyl 4-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 4-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 118585777 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | ethyl 4-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc(OC(F)(F)F)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H16F3NO4/c1-2-27-19(26)16-12-24(17-6-4-3-5-15(17)18(16)25)11-13-7-9-14(10-8-13)28-20(21,22)23/h3-10,12H,2,11H2,1H3 |
| InChIKey | DHYJGPONFILKOQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |