C19H18N2O3 — CID 143904177
ethyl 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)quinoline-3-carboxylate (PubChem CID 143904177) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is ethyl 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 143904177 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | ethyl 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccncc2)c2ccc(C)cc2c1=O |
| InChI | InChI=1S/C19H18N2O3/c1-3-24-19(23)16-12-21(11-14-6-8-20-9-7-14)17-5-4-13(2)10-15(17)18(16)22/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | QWDZZKZSRXGSEU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |