C17H14BrN3O3 — CID 87918839
ethyl 6-bromo-4-oxo-1-(pyridin-4-ylmethyl)-1,7-naphthyridine-3-carboxylate (PubChem CID 87918839) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is ethyl 6-bromo-4-oxo-1-(pyridin-4-ylmethyl)-1,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-oxo-1-(pyridin-4-ylmethyl)-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 87918839 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | ethyl 6-bromo-4-oxo-1-(pyridin-4-ylmethyl)-1,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccncc2)c2cnc(Br)cc2c1=O |
| InChI | InChI=1S/C17H14BrN3O3/c1-2-24-17(23)13-10-21(9-11-3-5-19-6-4-11)14-8-20-15(18)7-12(14)16(13)22/h3-8,10H,2,9H2,1H3 |
| InChIKey | ANOUOMQNSKRWAX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|