C14H15BrN2O4 — CID 87918822
ethyl 6-bromo-1-(2-methoxyethyl)-4-oxo-1,7-naphthyridine-3-carboxylate (PubChem CID 87918822) has the molecular formula C14H15BrN2O4 and a molecular weight of 355.19 g/mol. Its IUPAC name is ethyl 6-bromo-1-(2-methoxyethyl)-4-oxo-1,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-(2-methoxyethyl)-4-oxo-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 87918822 |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | ethyl 6-bromo-1-(2-methoxyethyl)-4-oxo-1,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCOC)c2cnc(Br)cc2c1=O |
| InChI | InChI=1S/C14H15BrN2O4/c1-3-21-14(19)10-8-17(4-5-20-2)11-7-16-12(15)6-9(11)13(10)18/h6-8H,3-5H2,1-2H3 |
| InChIKey | UJADNALRWLMULU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|