C14H16N2O4 — CID 10850045
ethyl 1-amino-6-ethoxy-4-oxoquinoline-3-carboxylate (PubChem CID 10850045) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is ethyl 1-amino-6-ethoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-amino-6-ethoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10850045 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ethyl 1-amino-6-ethoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(N)c2ccc(OCC)cc2c1=O |
| InChI | InChI=1S/C14H16N2O4/c1-3-19-9-5-6-12-10(7-9)13(17)11(8-16(12)15)14(18)20-4-2/h5-8H,3-4,15H2,1-2H3 |
| InChIKey | JXYFKIJDKGYLCE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |